adelo77 adelo77
  • 03-11-2019
  • Mathematics
contestada

cosec(6b+pi/8)=sec(2b-pi/8)​

Respuesta :

2002hemal
2002hemal 2002hemal
  • 03-11-2019

Step-by-step explanation:

cosec( 6b+ pie/8)=sec(2b-pie/8)

1/ sin( 6b +pie/8)=1/sec(2b-pie/8)

cos(2b-pie/8)=sin(6b-pie/8)

cosX =sin(pie/2-x)

sin(pie/2-2b+pie/8)=sin(6b+pie/8)

pie/2-2b+pie/8=6b+pie/8

pie/2=8b

b = pie/16

Ver imagen 2002hemal
Answer Link

Otras preguntas

Can Someone Help Me Solve This
Which statements are true? Check all that apply
WILL MARK BRAINLIEST!!!!!!!! HELP ASAP!!!!!! What sets a quatrain apart from other types of poetry components?
Mutters Sohn ist 1. meine Mutter 2. mein Bruder 3. meine Schwester 4. meine Bruder Vasters Vater ist 1. mein Grobvater 2. meine Grobmutter 3. mein Vater 4. mein
What happens when carbon dioxide at 74 c is placed in thermal contact with water at 14 c
According to the activity series for metals, will the following reaction occur? Cu(s)+HCl(aq)→?
Write this equation in vertex form. y = x^2 -12x +20
How did the growth of the railway system during the nineteeth century affect the U.S. Economy?
On a city map drawn on a coordinate plane, the city park is located at (4,9) and the school is at (20,9) what is the distance and the school in the map units? A
assume that lines that appear to be tangent are tangent o is the center of the circle